What is the structure of 2 methyl pent 2 ene?
Table of Contents
2-methylpent-2-ene
Compound number: | MolPort-003-938-589 |
---|---|
SMILES: | [#6]-[#6]\[#6]=[#6](\[#6])-[#6] |
InChI key: | JMMZCWZIJXAGKW-UHFFFAOYSA-N |
Molecular formula: | C6H12 |
Molecular weight: | 84.162 |
What color is 2 Methyl 2 hexanol?
Yellow
Specifications

Color | Yellow |
---|---|
Boiling Point | 143°C |
UN Number | 1987 |
Quantity | 5g |
Formula Weight | 116.20 |
What is the structure of 2 Methyl 2 hexene?
Identification of 2-METHYL-2-HEXENE Chemical Compound
Chemical Formula | C7H14 |
---|---|
IUPAC Name | 2-methylhex-2-ene |
SMILES String | CCCC=C(C)C |
InChI | InChI=1S/C7H14/c1-4-5-6-7(2)3/h6H,4-5H2,1-3H3 |
InChIKey | BWEKDYGHDCHWEN-UHFFFAOYSA-N |
What type of alcohol is 2 Methyl 2 hexanol?
Classification of Alcohols

Condensed Structural Formula | Class of Alcohol | IUPAC Name |
---|---|---|
CH 3CH 2CHOHCH 3 | secondary | 2-butanol |
(CH 3) 2(CH 3) 2CHCH 2OH | primary | 2-methyl-1-propanol |
(CH 3) 3COH | tertiary | 2-methyl-2-propanol |
secondary | cyclohexanol |
What is the structure of 2 methyl?
2-methyl-1-pentene is an alkene that is pent-1-ene carrying a methyl group at position 2. It has a role as a human metabolite. It is an alkene and a volatile organic compound. It derives from a hydride of a pentane.
Is 2-Methyl-2-hexanol a tertiary alcohol?
The 2-METHYL-2-HEXANOL molecule contains a total of 23 bond(s) There are 7 non-H bond(s), 3 rotatable bond(s), 1 hydroxyl group(s) and 1 tertiary alcohol(s). The 2D chemical structure image of 2-METHYL-2-HEXANOL is also called skeletal formula, which is the standard notation for organic molecules.
What is the melting point of 2-Methyl-2-hexanol?
141-142 °C
141-142 °C (lit.)
What type of hydrocarbon is 2 Methyl 2-hexene?
Thus, the structure below is 5-methyl-2-hexene….6.3: Unsaturated Hydrocarbons.
IUPAC Name | ethene |
---|---|
Molecular Formula | C2H4 |
Condensed Structural Formula | CH2=CH2 |
Melting Point (°C) | –169 |
Boiling Point (°C) | –104 |